HMB314H - Laboratory in Human Biology

Students analyze whole body, cellular, and molecular responses to stressors. Techniques range from those standard in medical practice (e.g., blood pressure) to those used in cutting-edge research laboratories (e.g., microarrays). Students gain technical and analytical skills as they use these laboratory techniques to design and carry out individual and group experiments.

Exclusion: HMB310H1/311H1/312H1
Prerequisite: BIO(220H1+230H1), HMB265H1/BIO260H1
Pre- or Co-requisite: PSL(300H1+301H1)/(BIO270H1+271H1)